C21H20N4O3S2 — CID 68835973
N-benzyl-N-methyl-2-(2H-[1,2,5]thiadiazolo[2,3-a]pyridin-4-ylsulfonylamino)benzamide (PubChem CID 68835973) has the molecular formula C21H20N4O3S2 and a molecular weight of 440.55 g/mol. Its IUPAC name is N-benzyl-N-methyl-2-(2H-[1,2,5]thiadiazolo[2,3-a]pyridin-4-ylsulfonylamino)benzamide.
| Compound Name | N-benzyl-N-methyl-2-(2H-[1,2,5]thiadiazolo[2,3-a]pyridin-4-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 68835973 |
| Molecular Formula | C21H20N4O3S2 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | N-benzyl-N-methyl-2-(2H-[1,2,5]thiadiazolo[2,3-a]pyridin-4-ylsulfonylamino)benzamide |
| SMILES | CN(Cc1ccccc1)C(=O)c1ccccc1NS(=O)(=O)C1=CC=CN2SNC=C12 |
| InChI | InChI=1S/C21H20N4O3S2/c1-24(15-16-8-3-2-4-9-16)21(26)17-10-5-6-11-18(17)23-30(27,28)20-12-7-13-25-19(20)14-22-29-25/h2-14,22-23H,15H2,1H3 |
| InChIKey | BOLBWERJHZNNKI-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|