C20H16BrClN4O3S2 — CID 68834101
N-[(2-bromophenyl)methyl]-4-chloro-2-(2H-[1,2,5]thiadiazolo[2,3-a]pyridin-4-ylsulfonylamino)benzamide (PubChem CID 68834101) has the molecular formula C20H16BrClN4O3S2 and a molecular weight of 539.86 g/mol. Its IUPAC name is N-[(2-bromophenyl)methyl]-4-chloro-2-(2H-[1,2,5]thiadiazolo[2,3-a]pyridin-4-ylsulfonylamino)benzamide.
| Compound Name | N-[(2-bromophenyl)methyl]-4-chloro-2-(2H-[1,2,5]thiadiazolo[2,3-a]pyridin-4-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 68834101 |
| Molecular Formula | C20H16BrClN4O3S2 |
| Molecular Weight | 539.86 g/mol |
| Exact Mass | 537.95 |
| IUPAC Name | N-[(2-bromophenyl)methyl]-4-chloro-2-(2H-[1,2,5]thiadiazolo[2,3-a]pyridin-4-ylsulfonylamino)benzamide |
| SMILES | O=C(NCc1ccccc1Br)c1ccc(Cl)cc1NS(=O)(=O)C1=CC=CN2SNC=C12 |
| InChI | InChI=1S/C20H16BrClN4O3S2/c21-16-5-2-1-4-13(16)11-23-20(27)15-8-7-14(22)10-17(15)25-31(28,29)19-6-3-9-26-18(19)12-24-30-26/h1-10,12,24-25H,11H2,(H,23,27) |
| InChIKey | QHAFYBGEEDEXIP-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.86 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|