C21H17BrCl2N4O3S2 — CID 68835324
4-bromo-N-[(1R)-1-(2,4-dichlorophenyl)ethyl]-2-(2H-[1,2,5]thiadiazolo[2,3-a]pyridin-4-ylsulfonylamino)benzamide (PubChem CID 68835324) has the molecular formula C21H17BrCl2N4O3S2 and a molecular weight of 588.34 g/mol. Its IUPAC name is 4-bromo-N-[(1R)-1-(2,4-dichlorophenyl)ethyl]-2-(2H-[1,2,5]thiadiazolo[2,3-a]pyridin-4-ylsulfonylamino)benzamide.
| Compound Name | 4-bromo-N-[(1R)-1-(2,4-dichlorophenyl)ethyl]-2-(2H-[1,2,5]thiadiazolo[2,3-a]pyridin-4-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 68835324 |
| Molecular Formula | C21H17BrCl2N4O3S2 |
| Molecular Weight | 588.34 g/mol |
| Exact Mass | 585.93 |
| IUPAC Name | 4-bromo-N-[(1R)-1-(2,4-dichlorophenyl)ethyl]-2-(2H-[1,2,5]thiadiazolo[2,3-a]pyridin-4-ylsulfonylamino)benzamide |
| SMILES | C[C@@H](NC(=O)c1ccc(Br)cc1NS(=O)(=O)C1=CC=CN2SNC=C12)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H17BrCl2N4O3S2/c1-12(15-7-5-14(23)10-17(15)24)26-21(29)16-6-4-13(22)9-18(16)27-33(30,31)20-3-2-8-28-19(20)11-25-32-28/h2-12,25,27H,1H3,(H,26,29)/t12-/m1/s1 |
| InChIKey | BGOKBSPPLJSROM-GFCCVEGCSA-N |
| XLogP | 5.71 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.34 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|