C21H17ClF2N4O3S2 — CID 68837551
5-chloro-N-[(2,4-difluorophenyl)methyl]-N-methyl-2-(2H-[1,2,5]thiadiazolo[2,3-a]pyridin-4-ylsulfonylamino)benzamide (PubChem CID 68837551) has the molecular formula C21H17ClF2N4O3S2 and a molecular weight of 510.98 g/mol. Its IUPAC name is 5-chloro-N-[(2,4-difluorophenyl)methyl]-N-methyl-2-(2H-[1,2,5]thiadiazolo[2,3-a]pyridin-4-ylsulfonylamino)benzamide.
| Compound Name | 5-chloro-N-[(2,4-difluorophenyl)methyl]-N-methyl-2-(2H-[1,2,5]thiadiazolo[2,3-a]pyridin-4-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 68837551 |
| Molecular Formula | C21H17ClF2N4O3S2 |
| Molecular Weight | 510.98 g/mol |
| Exact Mass | 510.04 |
| IUPAC Name | 5-chloro-N-[(2,4-difluorophenyl)methyl]-N-methyl-2-(2H-[1,2,5]thiadiazolo[2,3-a]pyridin-4-ylsulfonylamino)benzamide |
| SMILES | CN(Cc1ccc(F)cc1F)C(=O)c1cc(Cl)ccc1NS(=O)(=O)C1=CC=CN2SNC=C12 |
| InChI | InChI=1S/C21H17ClF2N4O3S2/c1-27(12-13-4-6-15(23)10-17(13)24)21(29)16-9-14(22)5-7-18(16)26-33(30,31)20-3-2-8-28-19(20)11-25-32-28/h2-11,25-26H,12H2,1H3 |
| InChIKey | FFLMSLTWOKTJFX-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.98 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|