C21H17Cl3N4O3S2 — CID 68830473
4-methyl-2-(2H-[1,2,5]thiadiazolo[2,3-a]pyridin-4-ylsulfonylamino)-N-[(2,4,6-trichlorophenyl)methyl]benzamide (PubChem CID 68830473) has the molecular formula C21H17Cl3N4O3S2 and a molecular weight of 543.89 g/mol. Its IUPAC name is 4-methyl-2-(2H-[1,2,5]thiadiazolo[2,3-a]pyridin-4-ylsulfonylamino)-N-[(2,4,6-trichlorophenyl)methyl]benzamide.
| Compound Name | 4-methyl-2-(2H-[1,2,5]thiadiazolo[2,3-a]pyridin-4-ylsulfonylamino)-N-[(2,4,6-trichlorophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 68830473 |
| Molecular Formula | C21H17Cl3N4O3S2 |
| Molecular Weight | 543.89 g/mol |
| Exact Mass | 541.98 |
| IUPAC Name | 4-methyl-2-(2H-[1,2,5]thiadiazolo[2,3-a]pyridin-4-ylsulfonylamino)-N-[(2,4,6-trichlorophenyl)methyl]benzamide |
| SMILES | Cc1ccc(C(=O)NCc2c(Cl)cc(Cl)cc2Cl)c(NS(=O)(=O)C2=CC=CN3SNC=C23)c1 |
| InChI | InChI=1S/C21H17Cl3N4O3S2/c1-12-4-5-14(21(29)25-10-15-16(23)8-13(22)9-17(15)24)18(7-12)27-33(30,31)20-3-2-6-28-19(20)11-26-32-28/h2-9,11,26-27H,10H2,1H3,(H,25,29) |
| InChIKey | XAAAOUCGJBGGPH-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.89 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|