C21H20ClN5O3S2 — CID 68770338
4-chloro-N-methyl-N-(2-pyridin-2-ylethyl)-2-(2H-[1,2,5]thiadiazolo[2,3-a]pyridin-4-ylsulfonylamino)benzamide (PubChem CID 68770338) has the molecular formula C21H20ClN5O3S2 and a molecular weight of 490.01 g/mol. Its IUPAC name is 4-chloro-N-methyl-N-(2-pyridin-2-ylethyl)-2-(2H-[1,2,5]thiadiazolo[2,3-a]pyridin-4-ylsulfonylamino)benzamide.
| Compound Name | 4-chloro-N-methyl-N-(2-pyridin-2-ylethyl)-2-(2H-[1,2,5]thiadiazolo[2,3-a]pyridin-4-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 68770338 |
| Molecular Formula | C21H20ClN5O3S2 |
| Molecular Weight | 490.01 g/mol |
| Exact Mass | 489.07 |
| IUPAC Name | 4-chloro-N-methyl-N-(2-pyridin-2-ylethyl)-2-(2H-[1,2,5]thiadiazolo[2,3-a]pyridin-4-ylsulfonylamino)benzamide |
| SMILES | CN(CCc1ccccn1)C(=O)c1ccc(Cl)cc1NS(=O)(=O)C1=CC=CN2SNC=C12 |
| InChI | InChI=1S/C21H20ClN5O3S2/c1-26(12-9-16-5-2-3-10-23-16)21(28)17-8-7-15(22)13-18(17)25-32(29,30)20-6-4-11-27-19(20)14-24-31-27/h2-8,10-11,13-14,24-25H,9,12H2,1H3 |
| InChIKey | ANMBECJONLFRBG-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.01 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|