C18H22CuN4O4 — CID 23344060
copper bis(2-(1,2-diaminoethyl)benzoate) (PubChem CID 23344060) has the molecular formula C18H22CuN4O4 and a molecular weight of 421.94 g/mol. Its IUPAC name is copper bis(2-(1,2-diaminoethyl)benzoate).
| Compound Name | copper bis(2-(1,2-diaminoethyl)benzoate) |
|---|---|
| PubChem CID | 23344060 |
| Molecular Formula | C18H22CuN4O4 |
| Molecular Weight | 421.94 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | copper bis(2-(1,2-diaminoethyl)benzoate) |
| SMILES | NCC(N)c1ccccc1C(=O)[O-].NCC(N)c1ccccc1C(=O)[O-].[Cu+2] |
| InChI | InChI=1S/2C9H12N2O2.Cu/c2*10-5-8(11)6-3-1-2-4-7(6)9(12)13;/h2*1-4,8H,5,10-11H2,(H,12,13);/q;;+2/p-2 |
| InChIKey | YJRJFTHVWDMEAA-UHFFFAOYSA-L |
| XLogP | -1.99 |
| TPSA | 184.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.94 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |