C16H27IO2 — CID 23344468
1-(cyclobutylmethyl)-3-[(E)-1-(1-ethoxyethoxy)-3-iodoprop-2-enyl]cyclobutane (PubChem CID 23344468) has the molecular formula C16H27IO2 and a molecular weight of 378.29 g/mol. Its IUPAC name is 1-(cyclobutylmethyl)-3-[(E)-1-(1-ethoxyethoxy)-3-iodoprop-2-enyl]cyclobutane.
| Compound Name | 1-(cyclobutylmethyl)-3-[(E)-1-(1-ethoxyethoxy)-3-iodoprop-2-enyl]cyclobutane |
|---|---|
| PubChem CID | 23344468 |
| Molecular Formula | C16H27IO2 |
| Molecular Weight | 378.29 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | 1-(cyclobutylmethyl)-3-[(E)-1-(1-ethoxyethoxy)-3-iodoprop-2-enyl]cyclobutane |
| SMILES | CCOC(C)OC(/C=C/I)C1CC(CC2CCC2)C1 |
| InChI | InChI=1S/C16H27IO2/c1-3-18-12(2)19-16(7-8-17)15-10-14(11-15)9-13-5-4-6-13/h7-8,12-16H,3-6,9-11H2,1-2H3/b8-7+ |
| InChIKey | UNEUMPWJUXHMPH-BQYQJAHWSA-N |
| XLogP | 4.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.29 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|