C22H39IO2 — CID 23344487
3-[3-[(E)-1-(1-ethoxyethoxy)-3-iodoprop-2-enyl]-1-ethylcyclobutyl]propylcyclohexane (PubChem CID 23344487) has the molecular formula C22H39IO2 and a molecular weight of 462.46 g/mol. Its IUPAC name is 3-[3-[(E)-1-(1-ethoxyethoxy)-3-iodoprop-2-enyl]-1-ethylcyclobutyl]propylcyclohexane.
| Compound Name | 3-[3-[(E)-1-(1-ethoxyethoxy)-3-iodoprop-2-enyl]-1-ethylcyclobutyl]propylcyclohexane |
|---|---|
| PubChem CID | 23344487 |
| Molecular Formula | C22H39IO2 |
| Molecular Weight | 462.46 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | 3-[3-[(E)-1-(1-ethoxyethoxy)-3-iodoprop-2-enyl]-1-ethylcyclobutyl]propylcyclohexane |
| SMILES | CCOC(C)OC(/C=C/I)C1CC(CC)(CCCC2CCCCC2)C1 |
| InChI | InChI=1S/C22H39IO2/c1-4-22(14-9-12-19-10-7-6-8-11-19)16-20(17-22)21(13-15-23)25-18(3)24-5-2/h13,15,18-21H,4-12,14,16-17H2,1-3H3/b15-13+ |
| InChIKey | MEZLKHRZSWQWBY-FYWRMAATSA-N |
| XLogP | 7.26 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.46 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|