C16H20O5 — CID 23345433
2-(carboxymethyl)-2-(3-methoxyphenyl)cyclohexane-1-carboxylic acid (PubChem CID 23345433) has the molecular formula C16H20O5 and a molecular weight of 292.33 g/mol. Its IUPAC name is 2-(carboxymethyl)-2-(3-methoxyphenyl)cyclohexane-1-carboxylic acid.
| Compound Name | 2-(carboxymethyl)-2-(3-methoxyphenyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 23345433 |
| Molecular Formula | C16H20O5 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 2-(carboxymethyl)-2-(3-methoxyphenyl)cyclohexane-1-carboxylic acid |
| SMILES | COc1cccc(C2(CC(=O)O)CCCCC2C(=O)O)c1 |
| InChI | InChI=1S/C16H20O5/c1-21-12-6-4-5-11(9-12)16(10-14(17)18)8-3-2-7-13(16)15(19)20/h4-6,9,13H,2-3,7-8,10H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | PKJQOFYKFVBGCZ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |