C19H29NO4 — CID 69027497
4-[3-[(1S,2S)-1-[(dimethylamino)methyl]-2-hydroxycyclohexyl]phenoxy]butanoic acid (PubChem CID 69027497) has the molecular formula C19H29NO4 and a molecular weight of 335.44 g/mol. Its IUPAC name is 4-[3-[(1S,2S)-1-[(dimethylamino)methyl]-2-hydroxycyclohexyl]phenoxy]butanoic acid.
| Compound Name | 4-[3-[(1S,2S)-1-[(dimethylamino)methyl]-2-hydroxycyclohexyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 69027497 |
| Molecular Formula | C19H29NO4 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | 4-[3-[(1S,2S)-1-[(dimethylamino)methyl]-2-hydroxycyclohexyl]phenoxy]butanoic acid |
| SMILES | CN(C)C[C@@]1(c2cccc(OCCCC(=O)O)c2)CCCC[C@@H]1O |
| InChI | InChI=1S/C19H29NO4/c1-20(2)14-19(11-4-3-9-17(19)21)15-7-5-8-16(13-15)24-12-6-10-18(22)23/h5,7-8,13,17,21H,3-4,6,9-12,14H2,1-2H3,(H,22,23)/t17-,19+/m0/s1 |
| InChIKey | XTWZCRDDMMYUDX-PKOBYXMFSA-N |
| XLogP | 2.66 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|