C35H44O8 — CID 23345613
8-(5-benzoylperoxycarbonyl-4-hexylcyclohex-2-en-1-yl)octanoyl benzenecarboperoxoate (PubChem CID 23345613) has the molecular formula C35H44O8 and a molecular weight of 592.73 g/mol. Its IUPAC name is 8-(5-benzoylperoxycarbonyl-4-hexylcyclohex-2-en-1-yl)octanoyl benzenecarboperoxoate.
| Compound Name | 8-(5-benzoylperoxycarbonyl-4-hexylcyclohex-2-en-1-yl)octanoyl benzenecarboperoxoate |
|---|---|
| PubChem CID | 23345613 |
| Molecular Formula | C35H44O8 |
| Molecular Weight | 592.73 g/mol |
| Exact Mass | 592.30 |
| IUPAC Name | 8-(5-benzoylperoxycarbonyl-4-hexylcyclohex-2-en-1-yl)octanoyl benzenecarboperoxoate |
| SMILES | CCCCCCC1C=CC(CCCCCCCC(=O)OOC(=O)c2ccccc2)CC1C(=O)OOC(=O)c1ccccc1 |
| InChI | InChI=1S/C35H44O8/c1-2-3-4-11-18-28-25-24-27(26-31(28)35(39)43-42-34(38)30-21-14-9-15-22-30)17-10-6-5-7-16-23-32(36)40-41-33(37)29-19-12-8-13-20-29/h8-9,12-15,19-22,24-25,27-28,31H,2-7,10-11,16-18,23,26H2,1H3 |
| InChIKey | JZHKFQPUKCNIMP-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.73 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|