C45H76O8 — CID 20609609
1-[[4-(ethenoxymethyl)cyclohexyl]methoxy]ethyl 2-[8-[1-[[4-(ethenoxymethyl)cyclohexyl]methoxy]ethoxy]-8-oxooctyl]-5-hexylcyclohex-3-ene-1-carboxylate (PubChem CID 20609609) has the molecular formula C45H76O8 and a molecular weight of 745.09 g/mol. Its IUPAC name is 1-[[4-(ethenoxymethyl)cyclohexyl]methoxy]ethyl 2-[8-[1-[[4-(ethenoxymethyl)cyclohexyl]methoxy]ethoxy]-8-oxooctyl]-5-hexylcyclohex-3-ene-1-carboxylate.
| Compound Name | 1-[[4-(ethenoxymethyl)cyclohexyl]methoxy]ethyl 2-[8-[1-[[4-(ethenoxymethyl)cyclohexyl]methoxy]ethoxy]-8-oxooctyl]-5-hexylcyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 20609609 |
| Molecular Formula | C45H76O8 |
| Molecular Weight | 745.09 g/mol |
| Exact Mass | 744.55 |
| IUPAC Name | 1-[[4-(ethenoxymethyl)cyclohexyl]methoxy]ethyl 2-[8-[1-[[4-(ethenoxymethyl)cyclohexyl]methoxy]ethoxy]-8-oxooctyl]-5-hexylcyclohex-3-ene-1-carboxylate |
| SMILES | C=COCC1CCC(COC(C)OC(=O)CCCCCCCC2C=CC(CCCCCC)CC2C(=O)OC(C)OCC2CCC(COC=C)CC2)CC1 |
| InChI | InChI=1S/C45H76O8/c1-6-9-10-14-17-37-28-29-42(43(30-37)45(47)53-36(5)51-34-41-26-22-39(23-27-41)32-49-8-3)18-15-12-11-13-16-19-44(46)52-35(4)50-33-40-24-20-38(21-25-40)31-48-7-2/h7-8,28-29,35-43H,2-3,6,9-27,30-34H2,1,4-5H3 |
| InChIKey | DYUJOAYVTONSKG-UHFFFAOYSA-N |
| XLogP | 11.24 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.09 |
| LogP ≤ 5 | 11.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|