C29H50O6 — CID 23345580
tert-butyl 5-(8-tert-butylperoxy-8-oxooctyl)-2-[(E)-hex-1-enyl]cyclohex-3-ene-1-carboperoxoate (PubChem CID 23345580) has the molecular formula C29H50O6 and a molecular weight of 494.71 g/mol. Its IUPAC name is tert-butyl 5-(8-tert-butylperoxy-8-oxooctyl)-2-[(E)-hex-1-enyl]cyclohex-3-ene-1-carboperoxoate.
| Compound Name | tert-butyl 5-(8-tert-butylperoxy-8-oxooctyl)-2-[(E)-hex-1-enyl]cyclohex-3-ene-1-carboperoxoate |
|---|---|
| PubChem CID | 23345580 |
| Molecular Formula | C29H50O6 |
| Molecular Weight | 494.71 g/mol |
| Exact Mass | 494.36 |
| IUPAC Name | tert-butyl 5-(8-tert-butylperoxy-8-oxooctyl)-2-[(E)-hex-1-enyl]cyclohex-3-ene-1-carboperoxoate |
| SMILES | CCCC/C=C/C1C=CC(CCCCCCCC(=O)OOC(C)(C)C)CC1C(=O)OOC(C)(C)C |
| InChI | InChI=1S/C29H50O6/c1-8-9-10-15-18-24-21-20-23(22-25(24)27(31)33-35-29(5,6)7)17-14-12-11-13-16-19-26(30)32-34-28(2,3)4/h15,18,20-21,23-25H,8-14,16-17,19,22H2,1-7H3/b18-15+ |
| InChIKey | LZIRTCIAHFWMKE-OBGWFSINSA-N |
| XLogP | 7.82 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.71 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|