C25H30N2O6S — CID 23347189
5-acetyl-2-methoxybenzenesulfonamide;N-benzyl-2-(2-methoxyphenoxy)ethanamine (PubChem CID 23347189) has the molecular formula C25H30N2O6S and a molecular weight of 486.59 g/mol. Its IUPAC name is 5-acetyl-2-methoxybenzenesulfonamide;N-benzyl-2-(2-methoxyphenoxy)ethanamine.
| Compound Name | 5-acetyl-2-methoxybenzenesulfonamide;N-benzyl-2-(2-methoxyphenoxy)ethanamine |
|---|---|
| PubChem CID | 23347189 |
| Molecular Formula | C25H30N2O6S |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | 5-acetyl-2-methoxybenzenesulfonamide;N-benzyl-2-(2-methoxyphenoxy)ethanamine |
| SMILES | COc1ccc(C(C)=O)cc1S(N)(=O)=O.COc1ccccc1OCCNCc1ccccc1 |
| InChI | InChI=1S/C16H19NO2.C9H11NO4S/c1-18-15-9-5-6-10-16(15)19-12-11-17-13-14-7-3-2-4-8-14;1-6(11)7-3-4-8(14-2)9(5-7)15(10,12)13/h2-10,17H,11-13H2,1H3;3-5H,1-2H3,(H2,10,12,13) |
| InChIKey | NYJNSRWXGHQLBU-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|