C18H19NO2 — CID 23351858
(1S,2S,6S,7S)-4-(2,3-dimethylphenyl)-2-methyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 23351858) has the molecular formula C18H19NO2 and a molecular weight of 281.35 g/mol. Its IUPAC name is (1S,2S,6S,7S)-4-(2,3-dimethylphenyl)-2-methyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1S,2S,6S,7S)-4-(2,3-dimethylphenyl)-2-methyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 23351858 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | (1S,2S,6S,7S)-4-(2,3-dimethylphenyl)-2-methyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | Cc1cccc(N2C(=O)[C@H]3[C@@H]4C=C[C@H](C4)[C@]3(C)C2=O)c1C |
| InChI | InChI=1S/C18H19NO2/c1-10-5-4-6-14(11(10)2)19-16(20)15-12-7-8-13(9-12)18(15,3)17(19)21/h4-8,12-13,15H,9H2,1-3H3/t12-,13-,15-,18+/m1/s1 |
| InChIKey | OZJVMIJHEXQGSW-GGKPKWOWSA-N |
| XLogP | 3.01 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|