C24H23NO5 — CID 23352078
2-butyl-1-[[4-(2-carboxyphenyl)phenyl]methyl]-6-oxopyridine-4-carboxylic acid (PubChem CID 23352078) has the molecular formula C24H23NO5 and a molecular weight of 405.45 g/mol. Its IUPAC name is 2-butyl-1-[[4-(2-carboxyphenyl)phenyl]methyl]-6-oxopyridine-4-carboxylic acid.
| Compound Name | 2-butyl-1-[[4-(2-carboxyphenyl)phenyl]methyl]-6-oxopyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 23352078 |
| Molecular Formula | C24H23NO5 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 2-butyl-1-[[4-(2-carboxyphenyl)phenyl]methyl]-6-oxopyridine-4-carboxylic acid |
| SMILES | CCCCc1cc(C(=O)O)cc(=O)n1Cc1ccc(-c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C24H23NO5/c1-2-3-6-19-13-18(23(27)28)14-22(26)25(19)15-16-9-11-17(12-10-16)20-7-4-5-8-21(20)24(29)30/h4-5,7-14H,2-3,6,15H2,1H3,(H,27,28)(H,29,30) |
| InChIKey | NKKPPXALRJNREZ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 96.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |