C26H20N2O4S — CID 23352158
4-[[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)acetyl]naphthalen-1-yl]methyl]-1,3-thiazolidine-2,5-dione (PubChem CID 23352158) has the molecular formula C26H20N2O4S and a molecular weight of 456.52 g/mol. Its IUPAC name is 4-[[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)acetyl]naphthalen-1-yl]methyl]-1,3-thiazolidine-2,5-dione.
| Compound Name | 4-[[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)acetyl]naphthalen-1-yl]methyl]-1,3-thiazolidine-2,5-dione |
|---|---|
| PubChem CID | 23352158 |
| Molecular Formula | C26H20N2O4S |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | 4-[[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)acetyl]naphthalen-1-yl]methyl]-1,3-thiazolidine-2,5-dione |
| SMILES | Cc1oc(-c2ccccc2)nc1CC(=O)c1ccc(CC2NC(=O)SC2=O)c2ccccc12 |
| InChI | InChI=1S/C26H20N2O4S/c1-15-21(27-24(32-15)16-7-3-2-4-8-16)14-23(29)20-12-11-17(18-9-5-6-10-19(18)20)13-22-25(30)33-26(31)28-22/h2-12,22H,13-14H2,1H3,(H,28,31) |
| InChIKey | URRUXVALKLPZFG-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|