C25H21N3O4S — CID 23352161
4-[[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]isoquinolin-1-yl]methyl]-1,3-thiazolidine-2,5-dione (PubChem CID 23352161) has the molecular formula C25H21N3O4S and a molecular weight of 459.53 g/mol. Its IUPAC name is 4-[[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]isoquinolin-1-yl]methyl]-1,3-thiazolidine-2,5-dione.
| Compound Name | 4-[[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]isoquinolin-1-yl]methyl]-1,3-thiazolidine-2,5-dione |
|---|---|
| PubChem CID | 23352161 |
| Molecular Formula | C25H21N3O4S |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | 4-[[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]isoquinolin-1-yl]methyl]-1,3-thiazolidine-2,5-dione |
| SMILES | Cc1oc(-c2ccccc2)nc1CCOc1cnc(CC2NC(=O)SC2=O)c2ccccc12 |
| InChI | InChI=1S/C25H21N3O4S/c1-15-19(27-23(32-15)16-7-3-2-4-8-16)11-12-31-22-14-26-20(17-9-5-6-10-18(17)22)13-21-24(29)33-25(30)28-21/h2-10,14,21H,11-13H2,1H3,(H,28,30) |
| InChIKey | XNEWRFSOXYVIHW-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|