C22H20N2O5 — CID 67655973
4-benzyl-2-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]-1,2-oxazolidine-3,5-dione (PubChem CID 67655973) has the molecular formula C22H20N2O5 and a molecular weight of 392.41 g/mol. Its IUPAC name is 4-benzyl-2-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]-1,2-oxazolidine-3,5-dione.
| Compound Name | 4-benzyl-2-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]-1,2-oxazolidine-3,5-dione |
|---|---|
| PubChem CID | 67655973 |
| Molecular Formula | C22H20N2O5 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 4-benzyl-2-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]-1,2-oxazolidine-3,5-dione |
| SMILES | Cc1oc(-c2ccccc2)nc1CCON1OC(=O)C(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C22H20N2O5/c1-15-19(23-20(28-15)17-10-6-3-7-11-17)12-13-27-24-21(25)18(22(26)29-24)14-16-8-4-2-5-9-16/h2-11,18H,12-14H2,1H3 |
| InChIKey | WMYJKSMRASZWSI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 81.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|