C22H20N2O4S — CID 23076474
3-benzyl-5-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]-1,3-thiazolidine-2,4-dione (PubChem CID 23076474) has the molecular formula C22H20N2O4S and a molecular weight of 408.48 g/mol. Its IUPAC name is 3-benzyl-5-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-benzyl-5-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 23076474 |
| Molecular Formula | C22H20N2O4S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | 3-benzyl-5-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1oc(-c2ccccc2)nc1CCOC1SC(=O)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C22H20N2O4S/c1-15-18(23-19(28-15)17-10-6-3-7-11-17)12-13-27-21-20(25)24(22(26)29-21)14-16-8-4-2-5-9-16/h2-11,21H,12-14H2,1H3 |
| InChIKey | SOSVJTCTRXEDSV-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|