C32H32N2O4 — CID 58977294
(1R,3aR,6aS)-5-benzyl-3a-methyl-1-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]-1,4,6,6a-tetrahydrofuro[3,4-c]pyrrol-3-one (PubChem CID 58977294) has the molecular formula C32H32N2O4 and a molecular weight of 508.62 g/mol. Its IUPAC name is (1R,3aR,6aS)-5-benzyl-3a-methyl-1-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]-1,4,6,6a-tetrahydrofuro[3,4-c]pyrrol-3-one.
| Compound Name | (1R,3aR,6aS)-5-benzyl-3a-methyl-1-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]-1,4,6,6a-tetrahydrofuro[3,4-c]pyrrol-3-one |
|---|---|
| PubChem CID | 58977294 |
| Molecular Formula | C32H32N2O4 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | (1R,3aR,6aS)-5-benzyl-3a-methyl-1-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]-1,4,6,6a-tetrahydrofuro[3,4-c]pyrrol-3-one |
| SMILES | Cc1oc(-c2ccccc2)nc1CCOc1ccc([C@@H]2OC(=O)[C@@]3(C)CN(Cc4ccccc4)C[C@@H]23)cc1 |
| InChI | InChI=1S/C32H32N2O4/c1-22-28(33-30(37-22)25-11-7-4-8-12-25)17-18-36-26-15-13-24(14-16-26)29-27-20-34(19-23-9-5-3-6-10-23)21-32(27,2)31(35)38-29/h3-16,27,29H,17-21H2,1-2H3/t27-,29-,32-/m0/s1 |
| InChIKey | KKQUJPMCEDRWAK-HYPZGNBFSA-N |
| XLogP | 6.01 |
| TPSA | 64.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |