C20H34O5S — CID 23355960
2-(2-ethoxyethoxy)-1-(4-octylphenyl)ethanesulfonic acid (PubChem CID 23355960) has the molecular formula C20H34O5S and a molecular weight of 386.55 g/mol. Its IUPAC name is 2-(2-ethoxyethoxy)-1-(4-octylphenyl)ethanesulfonic acid.
| Compound Name | 2-(2-ethoxyethoxy)-1-(4-octylphenyl)ethanesulfonic acid |
|---|---|
| PubChem CID | 23355960 |
| Molecular Formula | C20H34O5S |
| Molecular Weight | 386.55 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 2-(2-ethoxyethoxy)-1-(4-octylphenyl)ethanesulfonic acid |
| SMILES | CCCCCCCCc1ccc(C(COCCOCC)S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C20H34O5S/c1-3-5-6-7-8-9-10-18-11-13-19(14-12-18)20(26(21,22)23)17-25-16-15-24-4-2/h11-14,20H,3-10,15-17H2,1-2H3,(H,21,22,23) |
| InChIKey | IGPZAXKOLLELHL-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.55 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|