C18H29N4O3S+ — CID 2336259
2-methyl-N-(4-methylpiperazin-4-ium-1-yl)-5-piperidin-1-ylsulfonylbenzamide (PubChem CID 2336259) has the molecular formula C18H29N4O3S+ and a molecular weight of 381.52 g/mol. Its IUPAC name is 2-methyl-N-(4-methylpiperazin-4-ium-1-yl)-5-piperidin-1-ylsulfonylbenzamide.
| Compound Name | 2-methyl-N-(4-methylpiperazin-4-ium-1-yl)-5-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 2336259 |
| Molecular Formula | C18H29N4O3S+ |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.20 |
| IUPAC Name | 2-methyl-N-(4-methylpiperazin-4-ium-1-yl)-5-piperidin-1-ylsulfonylbenzamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCCC2)cc1C(=O)NN1CC[NH+](C)CC1 |
| InChI | InChI=1S/C18H28N4O3S/c1-15-6-7-16(26(24,25)22-8-4-3-5-9-22)14-17(15)18(23)19-21-12-10-20(2)11-13-21/h6-7,14H,3-5,8-13H2,1-2H3,(H,19,23)/p+1 |
| InChIKey | ATQPUZAANVDDJK-UHFFFAOYSA-O |
| XLogP | -0.36 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |