About 4-N,4-N,6-N,6-N-tetramethylpyrimidine-2,4,6-triamine
4-N,4-N,6-N,6-N-tetramethylpyrimidine-2,4,6-triamine (PubChem CID 23366638) has the molecular formula C8H15N5
and a molecular weight of 181.24 g/mol. Its IUPAC name is 4-N,4-N,6-N,6-N-tetramethylpyrimidine-2,4,6-triamine.
Analyze 4-N,4-N,6-N,6-N-tetramethylpyrimidine-2,4,6-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N,4-N,6-N,6-N-tetramethylpyrimidine-2,4,6-triamine?
The IUPAC name of 4-N,4-N,6-N,6-N-tetramethylpyrimidine-2,4,6-triamine (CID 23366638) is 4-N,4-N,6-N,6-N-tetramethylpyrimidine-2,4,6-triamine.
What is the SMILES notation for 4-N,4-N,6-N,6-N-tetramethylpyrimidine-2,4,6-triamine?
The canonical SMILES for 4-N,4-N,6-N,6-N-tetramethylpyrimidine-2,4,6-triamine is CN(C)c1cc(N(C)C)nc(N)n1.
What is the InChIKey of 4-N,4-N,6-N,6-N-tetramethylpyrimidine-2,4,6-triamine?
The InChIKey is MDFWRLUVKNZWCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N5/c1-12(2)6-5-7(13(3)4)11-8(9)10-6/h5H,1-4H3,(H2,9,10,11).
What are the key properties of 4-N,4-N,6-N,6-N-tetramethylpyrimidine-2,4,6-triamine?
4-N,4-N,6-N,6-N-tetramethylpyrimidine-2,4,6-triamine has a molecular weight of 181.24 g/mol, XLogP of 0.19, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N,4-N,6-N,6-N-tetramethylpyrimidine-2,4,6-triamine is sourced from PubChem (CID 23366638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).