C18H17N3O2 — CID 23368213
[4-(1H-imidazol-5-ylmethyl)phenyl]methyl N-phenylcarbamate (PubChem CID 23368213) has the molecular formula C18H17N3O2 and a molecular weight of 307.35 g/mol. Its IUPAC name is [4-(1H-imidazol-5-ylmethyl)phenyl]methyl N-phenylcarbamate.
| Compound Name | [4-(1H-imidazol-5-ylmethyl)phenyl]methyl N-phenylcarbamate |
|---|---|
| PubChem CID | 23368213 |
| Molecular Formula | C18H17N3O2 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | [4-(1H-imidazol-5-ylmethyl)phenyl]methyl N-phenylcarbamate |
| SMILES | O=C(Nc1ccccc1)OCc1ccc(Cc2cnc[nH]2)cc1 |
| InChI | InChI=1S/C18H17N3O2/c22-18(21-16-4-2-1-3-5-16)23-12-15-8-6-14(7-9-15)10-17-11-19-13-20-17/h1-9,11,13H,10,12H2,(H,19,20)(H,21,22) |
| InChIKey | WGVIWRHHBAGVLQ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |