C16H20N4O2 — CID 103393516
benzyl N-[3-(1H-imidazol-5-ylmethylamino)cyclobutyl]carbamate (PubChem CID 103393516) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is benzyl N-[3-(1H-imidazol-5-ylmethylamino)cyclobutyl]carbamate.
| Compound Name | benzyl N-[3-(1H-imidazol-5-ylmethylamino)cyclobutyl]carbamate |
|---|---|
| PubChem CID | 103393516 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | benzyl N-[3-(1H-imidazol-5-ylmethylamino)cyclobutyl]carbamate |
| SMILES | O=C(NC1CC(NCc2cnc[nH]2)C1)OCc1ccccc1 |
| InChI | InChI=1S/C16H20N4O2/c21-16(22-10-12-4-2-1-3-5-12)20-14-6-13(7-14)18-9-15-8-17-11-19-15/h1-5,8,11,13-14,18H,6-7,9-10H2,(H,17,19)(H,20,21) |
| InChIKey | RLUWMFNVWZDSFD-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |