C17H19ClN2O2S — CID 103393456
benzyl N-[3-[(5-chlorothiophen-2-yl)methylamino]cyclobutyl]carbamate (PubChem CID 103393456) has the molecular formula C17H19ClN2O2S and a molecular weight of 350.87 g/mol. Its IUPAC name is benzyl N-[3-[(5-chlorothiophen-2-yl)methylamino]cyclobutyl]carbamate.
| Compound Name | benzyl N-[3-[(5-chlorothiophen-2-yl)methylamino]cyclobutyl]carbamate |
|---|---|
| PubChem CID | 103393456 |
| Molecular Formula | C17H19ClN2O2S |
| Molecular Weight | 350.87 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | benzyl N-[3-[(5-chlorothiophen-2-yl)methylamino]cyclobutyl]carbamate |
| SMILES | O=C(NC1CC(NCc2ccc(Cl)s2)C1)OCc1ccccc1 |
| InChI | InChI=1S/C17H19ClN2O2S/c18-16-7-6-15(23-16)10-19-13-8-14(9-13)20-17(21)22-11-12-4-2-1-3-5-12/h1-7,13-14,19H,8-11H2,(H,20,21) |
| InChIKey | GRSIRIJPIIKEBL-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.87 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |