C13H18ClN3O4 — CID 23369524
1-[1-(6-chloro-2-pyridinyl)azetidin-3-yl]-N,N-dimethylmethanamine;oxalic acid (PubChem CID 23369524) has the molecular formula C13H18ClN3O4 and a molecular weight of 315.76 g/mol. Its IUPAC name is 1-[1-(6-chloro-2-pyridinyl)azetidin-3-yl]-N,N-dimethylmethanamine;oxalic acid.
| Compound Name | 1-[1-(6-chloro-2-pyridinyl)azetidin-3-yl]-N,N-dimethylmethanamine;oxalic acid |
|---|---|
| PubChem CID | 23369524 |
| Molecular Formula | C13H18ClN3O4 |
| Molecular Weight | 315.76 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 1-[1-(6-chloro-2-pyridinyl)azetidin-3-yl]-N,N-dimethylmethanamine;oxalic acid |
| SMILES | CN(C)CC1CN(c2cccc(Cl)n2)C1.O=C(O)C(=O)O |
| InChI | InChI=1S/C11H16ClN3.C2H2O4/c1-14(2)6-9-7-15(8-9)11-5-3-4-10(12)13-11;3-1(4)2(5)6/h3-5,9H,6-8H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | CLUQYYYPPXQFEY-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 93.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.76 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|