C19H25N3O5 — CID 23373448
2-[[1-(carboxymethyl)imidazol-4-yl]carbamoyl]benzoic acid;hexane (PubChem CID 23373448) has the molecular formula C19H25N3O5 and a molecular weight of 375.43 g/mol. Its IUPAC name is 2-[[1-(carboxymethyl)imidazol-4-yl]carbamoyl]benzoic acid;hexane.
| Compound Name | 2-[[1-(carboxymethyl)imidazol-4-yl]carbamoyl]benzoic acid;hexane |
|---|---|
| PubChem CID | 23373448 |
| Molecular Formula | C19H25N3O5 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 2-[[1-(carboxymethyl)imidazol-4-yl]carbamoyl]benzoic acid;hexane |
| SMILES | CCCCCC.O=C(O)Cn1cnc(NC(=O)c2ccccc2C(=O)O)c1 |
| InChI | InChI=1S/C13H11N3O5.C6H14/c17-11(18)6-16-5-10(14-7-16)15-12(19)8-3-1-2-4-9(8)13(20)21;1-3-5-6-4-2/h1-5,7H,6H2,(H,15,19)(H,17,18)(H,20,21);3-6H2,1-2H3 |
| InChIKey | FOMQIVMMMVCEBD-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|