C19H25N3O4 — CID 23373470
2-[4-[(4-hydroxyphenyl)methylcarbamoyl]imidazol-1-yl]octanoic acid (PubChem CID 23373470) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is 2-[4-[(4-hydroxyphenyl)methylcarbamoyl]imidazol-1-yl]octanoic acid.
| Compound Name | 2-[4-[(4-hydroxyphenyl)methylcarbamoyl]imidazol-1-yl]octanoic acid |
|---|---|
| PubChem CID | 23373470 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 2-[4-[(4-hydroxyphenyl)methylcarbamoyl]imidazol-1-yl]octanoic acid |
| SMILES | CCCCCCC(C(=O)O)n1cnc(C(=O)NCc2ccc(O)cc2)c1 |
| InChI | InChI=1S/C19H25N3O4/c1-2-3-4-5-6-17(19(25)26)22-12-16(21-13-22)18(24)20-11-14-7-9-15(23)10-8-14/h7-10,12-13,17,23H,2-6,11H2,1H3,(H,20,24)(H,25,26) |
| InChIKey | NVDDTQKAJBNXQG-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|