C20H29N3O2 — CID 14888753
N-benzyl-1-(2-hydroxynonan-3-yl)imidazole-4-carboxamide (PubChem CID 14888753) has the molecular formula C20H29N3O2 and a molecular weight of 343.47 g/mol. Its IUPAC name is N-benzyl-1-(2-hydroxynonan-3-yl)imidazole-4-carboxamide.
| Compound Name | N-benzyl-1-(2-hydroxynonan-3-yl)imidazole-4-carboxamide |
|---|---|
| PubChem CID | 14888753 |
| Molecular Formula | C20H29N3O2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | N-benzyl-1-(2-hydroxynonan-3-yl)imidazole-4-carboxamide |
| SMILES | CCCCCCC(C(C)O)n1cnc(C(=O)NCc2ccccc2)c1 |
| InChI | InChI=1S/C20H29N3O2/c1-3-4-5-9-12-19(16(2)24)23-14-18(22-15-23)20(25)21-13-17-10-7-6-8-11-17/h6-8,10-11,14-16,19,24H,3-5,9,12-13H2,1-2H3,(H,21,25) |
| InChIKey | CFWDVWNYKYWZEX-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|