C18H19NO3 — CID 23373810
N-[2-(1,3-benzodioxol-4-yloxy)ethyl]-2,3-dihydro-1H-inden-2-amine (PubChem CID 23373810) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-4-yloxy)ethyl]-2,3-dihydro-1H-inden-2-amine.
| Compound Name | N-[2-(1,3-benzodioxol-4-yloxy)ethyl]-2,3-dihydro-1H-inden-2-amine |
|---|---|
| PubChem CID | 23373810 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | N-[2-(1,3-benzodioxol-4-yloxy)ethyl]-2,3-dihydro-1H-inden-2-amine |
| SMILES | c1ccc2c(c1)CC(NCCOc1cccc3c1OCO3)C2 |
| InChI | InChI=1S/C18H19NO3/c1-2-5-14-11-15(10-13(14)4-1)19-8-9-20-16-6-3-7-17-18(16)22-12-21-17/h1-7,15,19H,8-12H2 |
| InChIKey | PNVUQTQMMVGKPU-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|