C16H18ClNO3 — CID 169103310
N-[3-(1,3-benzodioxol-4-yloxy)propyl]aniline;hydrochloride (PubChem CID 169103310) has the molecular formula C16H18ClNO3 and a molecular weight of 307.78 g/mol. Its IUPAC name is N-[3-(1,3-benzodioxol-4-yloxy)propyl]aniline;hydrochloride.
| Compound Name | N-[3-(1,3-benzodioxol-4-yloxy)propyl]aniline;hydrochloride |
|---|---|
| PubChem CID | 169103310 |
| Molecular Formula | C16H18ClNO3 |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | N-[3-(1,3-benzodioxol-4-yloxy)propyl]aniline;hydrochloride |
| SMILES | Cl.c1ccc(NCCCOc2cccc3c2OCO3)cc1 |
| InChI | InChI=1S/C16H17NO3.ClH/c1-2-6-13(7-3-1)17-10-5-11-18-14-8-4-9-15-16(14)20-12-19-15;/h1-4,6-9,17H,5,10-12H2;1H |
| InChIKey | PBZQXSAPSTURJG-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|