C16H10F3N3O6 — CID 23377288
3-[4-(furan-2-ylmethoxy)-3-nitrophenyl]-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione (PubChem CID 23377288) has the molecular formula C16H10F3N3O6 and a molecular weight of 397.27 g/mol. Its IUPAC name is 3-[4-(furan-2-ylmethoxy)-3-nitrophenyl]-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione.
| Compound Name | 3-[4-(furan-2-ylmethoxy)-3-nitrophenyl]-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 23377288 |
| Molecular Formula | C16H10F3N3O6 |
| Molecular Weight | 397.27 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | 3-[4-(furan-2-ylmethoxy)-3-nitrophenyl]-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione |
| SMILES | O=c1cc(C(F)(F)F)[nH]c(=O)n1-c1ccc(OCc2ccco2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H10F3N3O6/c17-16(18,19)13-7-14(23)21(15(24)20-13)9-3-4-12(11(6-9)22(25)26)28-8-10-2-1-5-27-10/h1-7H,8H2,(H,20,24) |
| InChIKey | OCBZECDOPXFKBV-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 120.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.27 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|