C11H21N2O2- — CID 23378346
N-(3-aminocyclohexyl)-1-[(2-methylpropan-2-yl)oxy]methanimidate (PubChem CID 23378346) has the molecular formula C11H21N2O2- and a molecular weight of 213.30 g/mol. Its IUPAC name is N-(3-aminocyclohexyl)-1-[(2-methylpropan-2-yl)oxy]methanimidate.
| Compound Name | N-(3-aminocyclohexyl)-1-[(2-methylpropan-2-yl)oxy]methanimidate |
|---|---|
| PubChem CID | 23378346 |
| Molecular Formula | C11H21N2O2- |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.16 |
| IUPAC Name | N-(3-aminocyclohexyl)-1-[(2-methylpropan-2-yl)oxy]methanimidate |
| SMILES | CC(C)(C)O/C([O-])=N/C1CCCC(N)C1 |
| InChI | InChI=1S/C11H22N2O2/c1-11(2,3)15-10(14)13-9-6-4-5-8(12)7-9/h8-9H,4-7,12H2,1-3H3,(H,13,14)/p-1 |
| InChIKey | OBSACSBMTRJNPH-UHFFFAOYSA-M |
| XLogP | 0.79 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|