C16H16N2OS — CID 23378657
1-[5-isocyano-2-(4-methylsulfanylphenoxy)phenyl]-N-methylmethanamine (PubChem CID 23378657) has the molecular formula C16H16N2OS and a molecular weight of 284.38 g/mol. Its IUPAC name is 1-[5-isocyano-2-(4-methylsulfanylphenoxy)phenyl]-N-methylmethanamine.
| Compound Name | 1-[5-isocyano-2-(4-methylsulfanylphenoxy)phenyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 23378657 |
| Molecular Formula | C16H16N2OS |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 1-[5-isocyano-2-(4-methylsulfanylphenoxy)phenyl]-N-methylmethanamine |
| SMILES | [C-]#[N+]c1ccc(Oc2ccc(SC)cc2)c(CNC)c1 |
| InChI | InChI=1S/C16H16N2OS/c1-17-11-12-10-13(18-2)4-9-16(12)19-14-5-7-15(20-3)8-6-14/h4-10,17H,11H2,1,3H3 |
| InChIKey | KXCXIXDCOGWFGK-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 25.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|