About N-(3,5-dichlorophenyl)-1-pyrrol-1-id-2-ylmethanimine;dichlorotitanium
N-(3,5-dichlorophenyl)-1-pyrrol-1-id-2-ylmethanimine;dichlorotitanium (PubChem CID 23380103) has the molecular formula C11H7Cl4N2Ti-
and a molecular weight of 356.87 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-1-pyrrol-1-id-2-ylmethanimine;dichlorotitanium.
Molecular Properties
| Compound Name | N-(3,5-dichlorophenyl)-1-pyrrol-1-id-2-ylmethanimine;dichlorotitanium |
| PubChem CID | 23380103 |
| Molecular Formula | C11H7Cl4N2Ti- |
| Molecular Weight | 356.87 g/mol |
| Exact Mass | 354.88 |
| IUPAC Name | N-(3,5-dichlorophenyl)-1-pyrrol-1-id-2-ylmethanimine;dichlorotitanium |
| SMILES | Cl[Ti]Cl.Clc1cc(Cl)cc(/N=C/c2ccc[n-]2)c1 |
| InChI | InChI=1S/C11H7Cl2N2.2ClH.Ti/c12-8-4-9(13)6-11(5-8)15-7-10-2-1-3-14-10;;;/h1-7H;2*1H;/q-1;;;+2/p-2/b15-7+;;; |
| InChIKey | FNFJSRDUFYPVLH-HFUUWOKWSA-L |
| XLogP | 5.08 |
| TPSA | 26.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.87 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(3,5-dichlorophenyl)-1-pyrrol-1-id-2-ylmethanimine;dichlorotitanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,5-dichlorophenyl)-1-pyrrol-1-id-2-ylmethanimine;dichlorotitanium?
The IUPAC name of N-(3,5-dichlorophenyl)-1-pyrrol-1-id-2-ylmethanimine;dichlorotitanium (CID 23380103) is N-(3,5-dichlorophenyl)-1-pyrrol-1-id-2-ylmethanimine;dichlorotitanium.
What is the SMILES notation for N-(3,5-dichlorophenyl)-1-pyrrol-1-id-2-ylmethanimine;dichlorotitanium?
The canonical SMILES for N-(3,5-dichlorophenyl)-1-pyrrol-1-id-2-ylmethanimine;dichlorotitanium is Cl[Ti]Cl.Clc1cc(Cl)cc(/N=C/c2ccc[n-]2)c1.
What is the InChIKey of N-(3,5-dichlorophenyl)-1-pyrrol-1-id-2-ylmethanimine;dichlorotitanium?
The InChIKey is FNFJSRDUFYPVLH-HFUUWOKWSA-L. The full InChI is InChI=1S/C11H7Cl2N2.2ClH.Ti/c12-8-4-9(13)6-11(5-8)15-7-10-2-1-3-14-10;;;/h1-7H;2*1H;/q-1;;;+2/p-2/b15-7+;;;.
What are the key properties of N-(3,5-dichlorophenyl)-1-pyrrol-1-id-2-ylmethanimine;dichlorotitanium?
N-(3,5-dichlorophenyl)-1-pyrrol-1-id-2-ylmethanimine;dichlorotitanium has a molecular weight of 356.87 g/mol, XLogP of 5.08, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,5-dichlorophenyl)-1-pyrrol-1-id-2-ylmethanimine;dichlorotitanium is sourced from PubChem (CID 23380103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).