C13H10F3N5OS — CID 23380695
(E)-4-[[3-(trifluoromethyl)-2,4,5,8,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl]sulfanyl]but-2-en-1-ol (PubChem CID 23380695) has the molecular formula C13H10F3N5OS and a molecular weight of 341.32 g/mol. Its IUPAC name is (E)-4-[[3-(trifluoromethyl)-2,4,5,8,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl]sulfanyl]but-2-en-1-ol.
| Compound Name | (E)-4-[[3-(trifluoromethyl)-2,4,5,8,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl]sulfanyl]but-2-en-1-ol |
|---|---|
| PubChem CID | 23380695 |
| Molecular Formula | C13H10F3N5OS |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | (E)-4-[[3-(trifluoromethyl)-2,4,5,8,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl]sulfanyl]but-2-en-1-ol |
| SMILES | OC/C=C/CSc1nc2cccnc2n2c(C(F)(F)F)nnc12 |
| InChI | InChI=1S/C13H10F3N5OS/c14-13(15,16)12-20-19-10-11(23-7-2-1-6-22)18-8-4-3-5-17-9(8)21(10)12/h1-5,22H,6-7H2/b2-1+ |
| InChIKey | GLUAFYIEQDAZDL-OWOJBTEDSA-N |
| XLogP | 2.33 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|