C20H17FN6O2 — CID 23381209
N'-[1-[(2-fluorophenyl)methyl]-3-(5-formylfuran-2-yl)pyrazolo[3,4-d]pyrimidin-4-yl]-N,N-dimethylmethanimidamide (PubChem CID 23381209) has the molecular formula C20H17FN6O2 and a molecular weight of 392.39 g/mol. Its IUPAC name is N'-[1-[(2-fluorophenyl)methyl]-3-(5-formylfuran-2-yl)pyrazolo[3,4-d]pyrimidin-4-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[1-[(2-fluorophenyl)methyl]-3-(5-formylfuran-2-yl)pyrazolo[3,4-d]pyrimidin-4-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 23381209 |
| Molecular Formula | C20H17FN6O2 |
| Molecular Weight | 392.39 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | N'-[1-[(2-fluorophenyl)methyl]-3-(5-formylfuran-2-yl)pyrazolo[3,4-d]pyrimidin-4-yl]-N,N-dimethylmethanimidamide |
| SMILES | CN(C)/C=N/c1ncnc2c1c(-c1ccc(C=O)o1)nn2Cc1ccccc1F |
| InChI | InChI=1S/C20H17FN6O2/c1-26(2)12-24-19-17-18(16-8-7-14(10-28)29-16)25-27(20(17)23-11-22-19)9-13-5-3-4-6-15(13)21/h3-8,10-12H,9H2,1-2H3/b24-12+ |
| InChIKey | SVHKPKHSGQLHRP-WYMPLXKRSA-N |
| XLogP | 3.31 |
| TPSA | 89.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.39 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|