C20H26N2 — CID 23381417
3-[(3-butylpyrrolidin-1-yl)-phenylmethyl]pyridine (PubChem CID 23381417) has the molecular formula C20H26N2 and a molecular weight of 294.44 g/mol. Its IUPAC name is 3-[(3-butylpyrrolidin-1-yl)-phenylmethyl]pyridine.
| Compound Name | 3-[(3-butylpyrrolidin-1-yl)-phenylmethyl]pyridine |
|---|---|
| PubChem CID | 23381417 |
| Molecular Formula | C20H26N2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 3-[(3-butylpyrrolidin-1-yl)-phenylmethyl]pyridine |
| SMILES | CCCCC1CCN(C(c2ccccc2)c2cccnc2)C1 |
| InChI | InChI=1S/C20H26N2/c1-2-3-8-17-12-14-22(16-17)20(18-9-5-4-6-10-18)19-11-7-13-21-15-19/h4-7,9-11,13,15,17,20H,2-3,8,12,14,16H2,1H3 |
| InChIKey | PNMSBRWJZVZMOR-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |