C9H12N2O — CID 23382278
1,3-dimethyl-3a,4-dihydrobenzimidazol-2-one (PubChem CID 23382278) has the molecular formula C9H12N2O and a molecular weight of 164.21 g/mol. Its IUPAC name is 1,3-dimethyl-3a,4-dihydrobenzimidazol-2-one.
| Compound Name | 1,3-dimethyl-3a,4-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 23382278 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 1,3-dimethyl-3a,4-dihydrobenzimidazol-2-one |
| SMILES | CN1C(=O)N(C)C2CC=CC=C21 |
| InChI | InChI=1S/C9H12N2O/c1-10-7-5-3-4-6-8(7)11(2)9(10)12/h3-5,8H,6H2,1-2H3 |
| InChIKey | BWAHXVLBGLXQTN-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |