C23H27FN2O2 — CID 23383835
propan-2-yl N-[4-[(3-fluorophenyl)-piperidin-4-ylidenemethyl]phenyl]-N-methylcarbamate (PubChem CID 23383835) has the molecular formula C23H27FN2O2 and a molecular weight of 382.48 g/mol. Its IUPAC name is propan-2-yl N-[4-[(3-fluorophenyl)-piperidin-4-ylidenemethyl]phenyl]-N-methylcarbamate.
| Compound Name | propan-2-yl N-[4-[(3-fluorophenyl)-piperidin-4-ylidenemethyl]phenyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 23383835 |
| Molecular Formula | C23H27FN2O2 |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | propan-2-yl N-[4-[(3-fluorophenyl)-piperidin-4-ylidenemethyl]phenyl]-N-methylcarbamate |
| SMILES | CC(C)OC(=O)N(C)c1ccc(C(=C2CCNCC2)c2cccc(F)c2)cc1 |
| InChI | InChI=1S/C23H27FN2O2/c1-16(2)28-23(27)26(3)21-9-7-17(8-10-21)22(18-11-13-25-14-12-18)19-5-4-6-20(24)15-19/h4-10,15-16,25H,11-14H2,1-3H3 |
| InChIKey | ATJJFQZHNYXYPL-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |