C7H13NO3 — CID 23388481
1-(3,4-dihydroxypyrrolidin-1-yl)propan-2-one (PubChem CID 23388481) has the molecular formula C7H13NO3 and a molecular weight of 159.18 g/mol. Its IUPAC name is 1-(3,4-dihydroxypyrrolidin-1-yl)propan-2-one.
| Compound Name | 1-(3,4-dihydroxypyrrolidin-1-yl)propan-2-one |
|---|---|
| PubChem CID | 23388481 |
| Molecular Formula | C7H13NO3 |
| Molecular Weight | 159.18 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | 1-(3,4-dihydroxypyrrolidin-1-yl)propan-2-one |
| SMILES | CC(=O)CN1CC(O)C(O)C1 |
| InChI | InChI=1S/C7H13NO3/c1-5(9)2-8-3-6(10)7(11)4-8/h6-7,10-11H,2-4H2,1H3 |
| InChIKey | BQXHEVUJEAXEDT-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.18 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |