C27H22N2O6S2 — CID 23390128
benzhydryl (6S)-7-amino-3-[(2-formylfuran-3-carbonyl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 23390128) has the molecular formula C27H22N2O6S2 and a molecular weight of 534.62 g/mol. Its IUPAC name is benzhydryl (6S)-7-amino-3-[(2-formylfuran-3-carbonyl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | benzhydryl (6S)-7-amino-3-[(2-formylfuran-3-carbonyl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 23390128 |
| Molecular Formula | C27H22N2O6S2 |
| Molecular Weight | 534.62 g/mol |
| Exact Mass | 534.09 |
| IUPAC Name | benzhydryl (6S)-7-amino-3-[(2-formylfuran-3-carbonyl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | NC1C(=O)N2C(C(=O)OC(c3ccccc3)c3ccccc3)=C(CSC(=O)c3ccoc3C=O)CS[C@@H]12 |
| InChI | InChI=1S/C27H22N2O6S2/c28-21-24(31)29-22(18(14-36-25(21)29)15-37-27(33)19-11-12-34-20(19)13-30)26(32)35-23(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-13,21,23,25H,14-15,28H2/t21?,25-/m0/s1 |
| InChIKey | LOGXSTLWWOFLRS-QBGQUKIHSA-N |
| XLogP | 3.79 |
| TPSA | 119.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.62 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|