C60H30N12O6 — CID 23391281
2-[3-[3,5-bis[3,5-bis([1,3]oxazolo[5,4-b]pyridin-2-yl)phenyl]phenyl]-5-([1,3]oxazolo[5,4-b]pyridin-2-yl)phenyl]-[1,3]oxazolo[5,4-b]pyridine (PubChem CID 23391281) has the molecular formula C60H30N12O6 and a molecular weight of 1014.98 g/mol. Its IUPAC name is 2-[3-[3,5-bis[3,5-bis([1,3]oxazolo[5,4-b]pyridin-2-yl)phenyl]phenyl]-5-([1,3]oxazolo[5,4-b]pyridin-2-yl)phenyl]-[1,3]oxazolo[5,4-b]pyridine.
| Compound Name | 2-[3-[3,5-bis[3,5-bis([1,3]oxazolo[5,4-b]pyridin-2-yl)phenyl]phenyl]-5-([1,3]oxazolo[5,4-b]pyridin-2-yl)phenyl]-[1,3]oxazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 23391281 |
| Molecular Formula | C60H30N12O6 |
| Molecular Weight | 1014.98 g/mol |
| Exact Mass | 1014.24 |
| IUPAC Name | 2-[3-[3,5-bis[3,5-bis([1,3]oxazolo[5,4-b]pyridin-2-yl)phenyl]phenyl]-5-([1,3]oxazolo[5,4-b]pyridin-2-yl)phenyl]-[1,3]oxazolo[5,4-b]pyridine |
| SMILES | c1cnc2oc(-c3cc(-c4cc(-c5cc(-c6nc7cccnc7o6)cc(-c6nc7cccnc7o6)c5)cc(-c5cc(-c6nc7cccnc7o6)cc(-c6nc7cccnc7o6)c5)c4)cc(-c4nc5cccnc5o4)c3)nc2c1 |
| InChI | InChI=1S/C60H30N12O6/c1-7-43-55(61-13-1)73-49(67-43)37-22-34(23-38(28-37)50-68-44-8-2-14-62-56(44)74-50)31-19-32(35-24-39(51-69-45-9-3-15-63-57(45)75-51)29-40(25-35)52-70-46-10-4-16-64-58(46)76-52)21-33(20-31)36-26-41(53-71-47-11-5-17-65-59(47)77-53)30-42(27-36)54-72-48-12-6-18-66-60(48)78-54/h1-30H |
| InChIKey | PCXDSFNIWVGOMT-UHFFFAOYSA-N |
| XLogP | 13.91 |
| TPSA | 233.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 78 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1014.98 |
| LogP ≤ 5 | 13.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |