C30H16N8O4 — CID 23391273
2-[2-(1,2-dihydro-[1,3]oxazolo[5,4-b]pyridin-2-yl)-4,5-bis([1,3]oxazolo[5,4-b]pyridin-2-yl)phenyl]-[1,3]oxazolo[5,4-b]pyridine (PubChem CID 23391273) has the molecular formula C30H16N8O4 and a molecular weight of 552.51 g/mol. Its IUPAC name is 2-[2-(1,2-dihydro-[1,3]oxazolo[5,4-b]pyridin-2-yl)-4,5-bis([1,3]oxazolo[5,4-b]pyridin-2-yl)phenyl]-[1,3]oxazolo[5,4-b]pyridine.
| Compound Name | 2-[2-(1,2-dihydro-[1,3]oxazolo[5,4-b]pyridin-2-yl)-4,5-bis([1,3]oxazolo[5,4-b]pyridin-2-yl)phenyl]-[1,3]oxazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 23391273 |
| Molecular Formula | C30H16N8O4 |
| Molecular Weight | 552.51 g/mol |
| Exact Mass | 552.13 |
| IUPAC Name | 2-[2-(1,2-dihydro-[1,3]oxazolo[5,4-b]pyridin-2-yl)-4,5-bis([1,3]oxazolo[5,4-b]pyridin-2-yl)phenyl]-[1,3]oxazolo[5,4-b]pyridine |
| SMILES | c1cnc2c(c1)NC(c1cc(-c3nc4cccnc4o3)c(-c3nc4cccnc4o3)cc1-c1nc3cccnc3o1)O2 |
| InChI | InChI=1S/C30H16N8O4/c1-5-19-27(31-9-1)39-23(35-19)15-13-17(25-37-21-7-3-11-33-29(21)41-25)18(26-38-22-8-4-12-34-30(22)42-26)14-16(15)24-36-20-6-2-10-32-28(20)40-24/h1-14,23,35H |
| InChIKey | BJMBIPIROLMRJR-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 150.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.51 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |