C49H28N8O4 — CID 23391328
2-[4-[tris[4-([1,3]oxazolo[5,4-b]pyridin-2-yl)phenyl]methyl]phenyl]-[1,3]oxazolo[5,4-b]pyridine (PubChem CID 23391328) has the molecular formula C49H28N8O4 and a molecular weight of 792.81 g/mol. Its IUPAC name is 2-[4-[tris[4-([1,3]oxazolo[5,4-b]pyridin-2-yl)phenyl]methyl]phenyl]-[1,3]oxazolo[5,4-b]pyridine.
| Compound Name | 2-[4-[tris[4-([1,3]oxazolo[5,4-b]pyridin-2-yl)phenyl]methyl]phenyl]-[1,3]oxazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 23391328 |
| Molecular Formula | C49H28N8O4 |
| Molecular Weight | 792.81 g/mol |
| Exact Mass | 792.22 |
| IUPAC Name | 2-[4-[tris[4-([1,3]oxazolo[5,4-b]pyridin-2-yl)phenyl]methyl]phenyl]-[1,3]oxazolo[5,4-b]pyridine |
| SMILES | c1cnc2oc(-c3ccc(C(c4ccc(-c5nc6cccnc6o5)cc4)(c4ccc(-c5nc6cccnc6o5)cc4)c4ccc(-c5nc6cccnc6o5)cc4)cc3)nc2c1 |
| InChI | InChI=1S/C49H28N8O4/c1-5-37-45(50-25-1)58-41(54-37)29-9-17-33(18-10-29)49(34-19-11-30(12-20-34)42-55-38-6-2-26-51-46(38)59-42,35-21-13-31(14-22-35)43-56-39-7-3-27-52-47(39)60-43)36-23-15-32(16-24-36)44-57-40-8-4-28-53-48(40)61-44/h1-28H |
| InChIKey | NQEODKZOWYYZHG-UHFFFAOYSA-N |
| XLogP | 10.88 |
| TPSA | 155.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.81 |
| LogP ≤ 5 | 10.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|