C72H44GeN12 — CID 23391365
3-phenyl-2-[3,3',7'-tris(3-phenylimidazo[4,5-b]pyridin-2-yl)-5,5'-spirobi[benzo[b][1]benzogermole]-7-yl]imidazo[4,5-b]pyridine (PubChem CID 23391365) has the molecular formula C72H44GeN12 and a molecular weight of 1149.84 g/mol. Its IUPAC name is 3-phenyl-2-[3,3',7'-tris(3-phenylimidazo[4,5-b]pyridin-2-yl)-5,5'-spirobi[benzo[b][1]benzogermole]-7-yl]imidazo[4,5-b]pyridine.
| Compound Name | 3-phenyl-2-[3,3',7'-tris(3-phenylimidazo[4,5-b]pyridin-2-yl)-5,5'-spirobi[benzo[b][1]benzogermole]-7-yl]imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 23391365 |
| Molecular Formula | C72H44GeN12 |
| Molecular Weight | 1149.84 g/mol |
| Exact Mass | 1150.30 |
| IUPAC Name | 3-phenyl-2-[3,3',7'-tris(3-phenylimidazo[4,5-b]pyridin-2-yl)-5,5'-spirobi[benzo[b][1]benzogermole]-7-yl]imidazo[4,5-b]pyridine |
| SMILES | c1ccc(-n2c(-c3ccc4c(c3)[Ge]3(c5cc(-c6nc7cccnc7n6-c6ccccc6)ccc5-4)c4cc(-c5nc6cccnc6n5-c5ccccc5)ccc4-c4ccc(-c5nc6cccnc6n5-c5ccccc5)cc43)nc3cccnc32)cc1 |
| InChI | InChI=1S/C72H44GeN12/c1-5-17-49(18-6-1)82-65(78-61-25-13-37-74-69(61)82)45-29-33-53-54-34-30-46(66-79-62-26-14-38-75-70(62)83(66)50-19-7-2-8-20-50)42-58(54)73(57(53)41-45)59-43-47(67-80-63-27-15-39-76-71(63)84(67)51-21-9-3-10-22-51)31-35-55(59)56-36-32-48(44-60(56)73)68-81-64-28-16-40-77-72(64)85(68)52-23-11-4-12-24-52/h1-44H |
| InChIKey | LPBJPBFBOPBARH-UHFFFAOYSA-N |
| XLogP | 12.63 |
| TPSA | 122.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 85 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1149.84 |
| LogP ≤ 5 | 12.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |