C32H40Cl2N6O6 — CID 23393038
(2,4,6-trimethylcyclohexyl) 5-[bis(2-chloroethyl)carbamoyloxy]-2-[2-(2,4-dimethylphenoxy)propanoylamino]-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate (PubChem CID 23393038) has the molecular formula C32H40Cl2N6O6 and a molecular weight of 675.61 g/mol. Its IUPAC name is (2,4,6-trimethylcyclohexyl) 5-[bis(2-chloroethyl)carbamoyloxy]-2-[2-(2,4-dimethylphenoxy)propanoylamino]-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate.
| Compound Name | (2,4,6-trimethylcyclohexyl) 5-[bis(2-chloroethyl)carbamoyloxy]-2-[2-(2,4-dimethylphenoxy)propanoylamino]-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
|---|---|
| PubChem CID | 23393038 |
| Molecular Formula | C32H40Cl2N6O6 |
| Molecular Weight | 675.61 g/mol |
| Exact Mass | 674.24 |
| IUPAC Name | (2,4,6-trimethylcyclohexyl) 5-[bis(2-chloroethyl)carbamoyloxy]-2-[2-(2,4-dimethylphenoxy)propanoylamino]-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
| SMILES | [C-]#[N+]c1c(C(=O)OC2C(C)CC(C)CC2C)c2nc(NC(=O)C(C)Oc3ccc(C)cc3C)[nH]n2c1OC(=O)N(CCCl)CCCl |
| InChI | InChI=1S/C32H40Cl2N6O6/c1-17-8-9-23(19(3)14-17)44-22(6)28(41)37-31-36-27-24(30(42)45-26-20(4)15-18(2)16-21(26)5)25(35-7)29(40(27)38-31)46-32(43)39(12-10-33)13-11-34/h8-9,14,18,20-22,26H,10-13,15-16H2,1-6H3,(H2,36,37,38,41) |
| InChIKey | ZVKUIHYOBDHUJH-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 131.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.61 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|